C22H17FN4O2 — CID 135455753
4-fluoro-N-[(5-phenylmethoxy-1H-pyrrolo[2,3-c]pyridin-3-yl)methylideneamino]benzamide (PubChem CID 135455753) has the molecular formula C22H17FN4O2 and a molecular weight of 388.40 g/mol. Its IUPAC name is 4-fluoro-N-[(5-phenylmethoxy-1H-pyrrolo[2,3-c]pyridin-3-yl)methylideneamino]benzamide.
| Compound Name | 4-fluoro-N-[(5-phenylmethoxy-1H-pyrrolo[2,3-c]pyridin-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135455753 |
| Molecular Formula | C22H17FN4O2 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 4-fluoro-N-[(5-phenylmethoxy-1H-pyrrolo[2,3-c]pyridin-3-yl)methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1c[nH]c2cnc(OCc3ccccc3)cc12)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H17FN4O2/c23-18-8-6-16(7-9-18)22(28)27-26-12-17-11-24-20-13-25-21(10-19(17)20)29-14-15-4-2-1-3-5-15/h1-13,24H,14H2,(H,27,28) |
| InChIKey | VUOCLAJQHHRRNO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|