C23H18IN3O2 — CID 137069759
3-iodo-N-[(Z)-(5-phenylmethoxy-1H-indol-3-yl)methylideneamino]benzamide (PubChem CID 137069759) has the molecular formula C23H18IN3O2 and a molecular weight of 495.32 g/mol. Its IUPAC name is 3-iodo-N-[(Z)-(5-phenylmethoxy-1H-indol-3-yl)methylideneamino]benzamide.
| Compound Name | 3-iodo-N-[(Z)-(5-phenylmethoxy-1H-indol-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 137069759 |
| Molecular Formula | C23H18IN3O2 |
| Molecular Weight | 495.32 g/mol |
| Exact Mass | 495.04 |
| IUPAC Name | 3-iodo-N-[(Z)-(5-phenylmethoxy-1H-indol-3-yl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1c[nH]c2ccc(OCc3ccccc3)cc12)c1cccc(I)c1 |
| InChI | InChI=1S/C23H18IN3O2/c24-19-8-4-7-17(11-19)23(28)27-26-14-18-13-25-22-10-9-20(12-21(18)22)29-15-16-5-2-1-3-6-16/h1-14,25H,15H2,(H,27,28)/b26-14- |
| InChIKey | RKLLLMLCURHWIJ-WGARJPEWSA-N |
| XLogP | 5.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.32 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|