C23H18ClN3O2 — CID 137069607
4-chloro-N-[(Z)-(5-phenylmethoxy-1H-indol-3-yl)methylideneamino]benzamide (PubChem CID 137069607) has the molecular formula C23H18ClN3O2 and a molecular weight of 403.87 g/mol. Its IUPAC name is 4-chloro-N-[(Z)-(5-phenylmethoxy-1H-indol-3-yl)methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(Z)-(5-phenylmethoxy-1H-indol-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 137069607 |
| Molecular Formula | C23H18ClN3O2 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 4-chloro-N-[(Z)-(5-phenylmethoxy-1H-indol-3-yl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1c[nH]c2ccc(OCc3ccccc3)cc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18ClN3O2/c24-19-8-6-17(7-9-19)23(28)27-26-14-18-13-25-22-11-10-20(12-21(18)22)29-15-16-4-2-1-3-5-16/h1-14,25H,15H2,(H,27,28)/b26-14- |
| InChIKey | WGQVZBWYXMTUOY-WGARJPEWSA-N |
| XLogP | 5.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|