C22H24FNO2S — CID 166732864
(2S)-2-[(3aS,6aR)-5-benzyl-5-fluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)-2-sulfanylethanone (PubChem CID 166732864) has the molecular formula C22H24FNO2S and a molecular weight of 385.50 g/mol. Its IUPAC name is (2S)-2-[(3aS,6aR)-5-benzyl-5-fluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)-2-sulfanylethanone.
| Compound Name | (2S)-2-[(3aS,6aR)-5-benzyl-5-fluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)-2-sulfanylethanone |
|---|---|
| PubChem CID | 166732864 |
| Molecular Formula | C22H24FNO2S |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (2S)-2-[(3aS,6aR)-5-benzyl-5-fluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)-2-sulfanylethanone |
| SMILES | O=C(c1ccc(O)cc1)[C@H](S)N1C[C@@H]2CC(F)(Cc3ccccc3)C[C@@H]2C1 |
| InChI | InChI=1S/C22H24FNO2S/c23-22(10-15-4-2-1-3-5-15)11-17-13-24(14-18(17)12-22)21(27)20(26)16-6-8-19(25)9-7-16/h1-9,17-18,21,25,27H,10-14H2/t17-,18+,21-,22?/m0/s1 |
| InChIKey | DRIILALXJYBZSL-LAVFIBBASA-N |
| XLogP | 4.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|