C26H37NO2 — CID 144818741
2-[(3aR,6aS)-5-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)ethanone;ethane (PubChem CID 144818741) has the molecular formula C26H37NO2 and a molecular weight of 395.59 g/mol. Its IUPAC name is 2-[(3aR,6aS)-5-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)ethanone;ethane.
| Compound Name | 2-[(3aR,6aS)-5-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)ethanone;ethane |
|---|---|
| PubChem CID | 144818741 |
| Molecular Formula | C26H37NO2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | 2-[(3aR,6aS)-5-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)ethanone;ethane |
| SMILES | CC.CC.O=C(CN1C[C@H]2CC(Cc3ccccc3)C[C@H]2C1)c1ccc(O)cc1 |
| InChI | InChI=1S/C22H25NO2.2C2H6/c24-21-8-6-18(7-9-21)22(25)15-23-13-19-11-17(12-20(19)14-23)10-16-4-2-1-3-5-16;2*1-2/h1-9,17,19-20,24H,10-15H2;2*1-2H3/t17?,19-,20+;; |
| InChIKey | RSIDLMJJRBEXFZ-UEPBWORCSA-N |
| XLogP | 5.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |