C21H23FN2O2 — CID 138650603
2-[(3aR,6aS)-5-[(2-fluoro-3-pyridinyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)ethanone (PubChem CID 138650603) has the molecular formula C21H23FN2O2 and a molecular weight of 354.42 g/mol. Its IUPAC name is 2-[(3aR,6aS)-5-[(2-fluoro-3-pyridinyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)ethanone.
| Compound Name | 2-[(3aR,6aS)-5-[(2-fluoro-3-pyridinyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 138650603 |
| Molecular Formula | C21H23FN2O2 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-[(3aR,6aS)-5-[(2-fluoro-3-pyridinyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)ethanone |
| SMILES | O=C(CN1C[C@H]2CC(Cc3cccnc3F)C[C@H]2C1)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H23FN2O2/c22-21-16(2-1-7-23-21)8-14-9-17-11-24(12-18(17)10-14)13-20(26)15-3-5-19(25)6-4-15/h1-7,14,17-18,25H,8-13H2/t14?,17-,18+ |
| InChIKey | YPDNSBAJILSROH-DODVFSASSA-N |
| XLogP | 3.31 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|