C14H17FN2O3 — CID 144818973
2-[(3aS,6aR)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(6-fluoro-5-hydroxy-2-pyridinyl)ethanone (PubChem CID 144818973) has the molecular formula C14H17FN2O3 and a molecular weight of 280.30 g/mol. Its IUPAC name is 2-[(3aS,6aR)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(6-fluoro-5-hydroxy-2-pyridinyl)ethanone.
| Compound Name | 2-[(3aS,6aR)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(6-fluoro-5-hydroxy-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 144818973 |
| Molecular Formula | C14H17FN2O3 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-[(3aS,6aR)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(6-fluoro-5-hydroxy-2-pyridinyl)ethanone |
| SMILES | O=C(CN1C[C@H]2CC(O)C[C@H]2C1)c1ccc(O)c(F)n1 |
| InChI | InChI=1S/C14H17FN2O3/c15-14-12(19)2-1-11(16-14)13(20)7-17-5-8-3-10(18)4-9(8)6-17/h1-2,8-10,18-19H,3-7H2/t8-,9+,10? |
| InChIKey | JLQPMOCDNLLWFY-ULKQDVFKSA-N |
| XLogP | 0.81 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|