C18H25NO3 — CID 144818736
2-[(3aS,6aR)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-[4-(2-hydroxypropan-2-yl)phenyl]ethanone (PubChem CID 144818736) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 2-[(3aS,6aR)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-[4-(2-hydroxypropan-2-yl)phenyl]ethanone.
| Compound Name | 2-[(3aS,6aR)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-[4-(2-hydroxypropan-2-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 144818736 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-[(3aS,6aR)-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-[4-(2-hydroxypropan-2-yl)phenyl]ethanone |
| SMILES | CC(C)(O)c1ccc(C(=O)CN2C[C@H]3CC(O)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C18H25NO3/c1-18(2,22)15-5-3-12(4-6-15)17(21)11-19-9-13-7-16(20)8-14(13)10-19/h3-6,13-14,16,20,22H,7-11H2,1-2H3/t13-,14+,16? |
| InChIKey | ZOONIPYTCZCYPJ-MZBDJJRSSA-N |
| XLogP | 1.80 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |