C21H44N2 — CID 166733475
N,2-dimethyl-N-[[1-(5-methyloctyl)piperidin-4-yl]methyl]butan-1-amine (PubChem CID 166733475) has the molecular formula C21H44N2 and a molecular weight of 324.60 g/mol. Its IUPAC name is N,2-dimethyl-N-[[1-(5-methyloctyl)piperidin-4-yl]methyl]butan-1-amine.
| Compound Name | N,2-dimethyl-N-[[1-(5-methyloctyl)piperidin-4-yl]methyl]butan-1-amine |
|---|---|
| PubChem CID | 166733475 |
| Molecular Formula | C21H44N2 |
| Molecular Weight | 324.60 g/mol |
| Exact Mass | 324.35 |
| IUPAC Name | N,2-dimethyl-N-[[1-(5-methyloctyl)piperidin-4-yl]methyl]butan-1-amine |
| SMILES | CCCC(C)CCCCN1CCC(CN(C)CC(C)CC)CC1 |
| InChI | InChI=1S/C21H44N2/c1-6-10-20(4)11-8-9-14-23-15-12-21(13-16-23)18-22(5)17-19(3)7-2/h19-21H,6-18H2,1-5H3 |
| InChIKey | GGHINDSMWQDHHZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.60 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|