C12H24BrN — CID 80690370
N-[(3-bromocyclobutyl)methyl]-N,2-dimethylpentan-1-amine (PubChem CID 80690370) has the molecular formula C12H24BrN and a molecular weight of 262.23 g/mol. Its IUPAC name is N-[(3-bromocyclobutyl)methyl]-N,2-dimethylpentan-1-amine.
| Compound Name | N-[(3-bromocyclobutyl)methyl]-N,2-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 80690370 |
| Molecular Formula | C12H24BrN |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-[(3-bromocyclobutyl)methyl]-N,2-dimethylpentan-1-amine |
| SMILES | CCCC(C)CN(C)CC1CC(Br)C1 |
| InChI | InChI=1S/C12H24BrN/c1-4-5-10(2)8-14(3)9-11-6-12(13)7-11/h10-12H,4-9H2,1-3H3 |
| InChIKey | DAGGJIDTZPITMO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|