C10H20BrN — CID 64994702
3-bromo-N-(cyclobutylmethyl)-N,2-dimethylpropan-1-amine (PubChem CID 64994702) has the molecular formula C10H20BrN and a molecular weight of 234.18 g/mol. Its IUPAC name is 3-bromo-N-(cyclobutylmethyl)-N,2-dimethylpropan-1-amine.
| Compound Name | 3-bromo-N-(cyclobutylmethyl)-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 64994702 |
| Molecular Formula | C10H20BrN |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 3-bromo-N-(cyclobutylmethyl)-N,2-dimethylpropan-1-amine |
| SMILES | CC(CBr)CN(C)CC1CCC1 |
| InChI | InChI=1S/C10H20BrN/c1-9(6-11)7-12(2)8-10-4-3-5-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | CBYOELFJLIJDOV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|