C11H23NO2 — CID 66222142
N-(cyclopentylmethyl)-2,2-dimethoxy-N-methylethanamine (PubChem CID 66222142) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-2,2-dimethoxy-N-methylethanamine.
| Compound Name | N-(cyclopentylmethyl)-2,2-dimethoxy-N-methylethanamine |
|---|---|
| PubChem CID | 66222142 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | N-(cyclopentylmethyl)-2,2-dimethoxy-N-methylethanamine |
| SMILES | COC(CN(C)CC1CCCC1)OC |
| InChI | InChI=1S/C11H23NO2/c1-12(9-11(13-2)14-3)8-10-6-4-5-7-10/h10-11H,4-9H2,1-3H3 |
| InChIKey | HDJWCLKIIIJPIC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|