C19H20FN3S — CID 16673458
1-(2-fluorophenyl)-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]cyclopentan-1-amine (PubChem CID 16673458) has the molecular formula C19H20FN3S and a molecular weight of 341.46 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]cyclopentan-1-amine.
| Compound Name | 1-(2-fluorophenyl)-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 16673458 |
| Molecular Formula | C19H20FN3S |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]cyclopentan-1-amine |
| SMILES | Fc1ccccc1C1(NCc2cn[nH]c2-c2cccs2)CCCC1 |
| InChI | InChI=1S/C19H20FN3S/c20-16-7-2-1-6-15(16)19(9-3-4-10-19)21-12-14-13-22-23-18(14)17-8-5-11-24-17/h1-2,5-8,11,13,21H,3-4,9-10,12H2,(H,22,23) |
| InChIKey | GPHQPIGVEFSXQP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |