C9H21NO — CID 166738532
N-butoxy-N,2-dimethylpropan-1-amine (PubChem CID 166738532) has the molecular formula C9H21NO and a molecular weight of 159.27 g/mol. Its IUPAC name is N-butoxy-N,2-dimethylpropan-1-amine.
| Compound Name | N-butoxy-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 166738532 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | N-butoxy-N,2-dimethylpropan-1-amine |
| SMILES | CCCCON(C)CC(C)C |
| InChI | InChI=1S/C9H21NO/c1-5-6-7-11-10(4)8-9(2)3/h9H,5-8H2,1-4H3 |
| InChIKey | LTPPITPNQFHWDP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|