C18H26FN5O2S — CID 16673861
1-ethyl-N-[2-(4-fluorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]pyrazole-4-sulfonamide (PubChem CID 16673861) has the molecular formula C18H26FN5O2S and a molecular weight of 395.50 g/mol. Its IUPAC name is 1-ethyl-N-[2-(4-fluorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]pyrazole-4-sulfonamide.
| Compound Name | 1-ethyl-N-[2-(4-fluorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 16673861 |
| Molecular Formula | C18H26FN5O2S |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 1-ethyl-N-[2-(4-fluorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NCC(c2ccc(F)cc2)N2CCN(C)CC2)cn1 |
| InChI | InChI=1S/C18H26FN5O2S/c1-3-24-14-17(12-20-24)27(25,26)21-13-18(15-4-6-16(19)7-5-15)23-10-8-22(2)9-11-23/h4-7,12,14,18,21H,3,8-11,13H2,1-2H3 |
| InChIKey | JDQHZFRJVOXNQZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |