C21H27ClN4O4 — CID 166740287
N-[4-(6-acetamidohexanoyl)-2,3-dihydro-1,4-benzoxazin-6-yl]-2-chloro-N-(2-cyanoethyl)acetamide (PubChem CID 166740287) has the molecular formula C21H27ClN4O4 and a molecular weight of 434.92 g/mol. Its IUPAC name is N-[4-(6-acetamidohexanoyl)-2,3-dihydro-1,4-benzoxazin-6-yl]-2-chloro-N-(2-cyanoethyl)acetamide.
| Compound Name | N-[4-(6-acetamidohexanoyl)-2,3-dihydro-1,4-benzoxazin-6-yl]-2-chloro-N-(2-cyanoethyl)acetamide |
|---|---|
| PubChem CID | 166740287 |
| Molecular Formula | C21H27ClN4O4 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | N-[4-(6-acetamidohexanoyl)-2,3-dihydro-1,4-benzoxazin-6-yl]-2-chloro-N-(2-cyanoethyl)acetamide |
| SMILES | CC(=O)NCCCCCC(=O)N1CCOc2ccc(N(CCC#N)C(=O)CCl)cc21 |
| InChI | InChI=1S/C21H27ClN4O4/c1-16(27)24-10-4-2-3-6-20(28)26-12-13-30-19-8-7-17(14-18(19)26)25(11-5-9-23)21(29)15-22/h7-8,14H,2-6,10-13,15H2,1H3,(H,24,27) |
| InChIKey | KBALBCDAWYNQIP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|