C18H22ClN3O4 — CID 156853220
tert-butyl 6-[(2-chloroacetyl)-(2-cyanoethyl)amino]-2,3-dihydro-1,4-benzoxazine-4-carboxylate (PubChem CID 156853220) has the molecular formula C18H22ClN3O4 and a molecular weight of 379.84 g/mol. Its IUPAC name is tert-butyl 6-[(2-chloroacetyl)-(2-cyanoethyl)amino]-2,3-dihydro-1,4-benzoxazine-4-carboxylate.
| Compound Name | tert-butyl 6-[(2-chloroacetyl)-(2-cyanoethyl)amino]-2,3-dihydro-1,4-benzoxazine-4-carboxylate |
|---|---|
| PubChem CID | 156853220 |
| Molecular Formula | C18H22ClN3O4 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | tert-butyl 6-[(2-chloroacetyl)-(2-cyanoethyl)amino]-2,3-dihydro-1,4-benzoxazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOc2ccc(N(CCC#N)C(=O)CCl)cc21 |
| InChI | InChI=1S/C18H22ClN3O4/c1-18(2,3)26-17(24)22-9-10-25-15-6-5-13(11-14(15)22)21(8-4-7-20)16(23)12-19/h5-6,11H,4,8-10,12H2,1-3H3 |
| InChIKey | ALQZJQWEARKRDT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|