C34H24ClN3O — CID 166743688
2-(4-chlorodibenzofuran-1-yl)-4-[4-[(2Z,4Z)-hepta-2,4,6-trienyl]phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 166743688) has the molecular formula C34H24ClN3O and a molecular weight of 526.04 g/mol. Its IUPAC name is 2-(4-chlorodibenzofuran-1-yl)-4-[4-[(2Z,4Z)-hepta-2,4,6-trienyl]phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(4-chlorodibenzofuran-1-yl)-4-[4-[(2Z,4Z)-hepta-2,4,6-trienyl]phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 166743688 |
| Molecular Formula | C34H24ClN3O |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | 2-(4-chlorodibenzofuran-1-yl)-4-[4-[(2Z,4Z)-hepta-2,4,6-trienyl]phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | C=C/C=C\C=C/Cc1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(Cl)c4oc5ccccc5c34)n2)cc1 |
| InChI | InChI=1S/C34H24ClN3O/c1-2-3-4-5-7-12-23-17-19-25(20-18-23)33-36-32(24-13-8-6-9-14-24)37-34(38-33)27-21-22-28(35)31-30(27)26-15-10-11-16-29(26)39-31/h2-11,13-22H,1,12H2/b4-3-,7-5- |
| InChIKey | KKYAGDSLFFKUMR-MRWCJKGFSA-N |
| XLogP | 9.27 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|