C45H35N3O — CID 170133792
2-[(2Z,4Z)-hepta-2,4,6-trienyl]-4-[6-(6-methylcyclohexa-1,3-dien-1-yl)naphthalen-2-yl]-6-(4-phenyldibenzofuran-1-yl)-1,3,5-triazine (PubChem CID 170133792) has the molecular formula C45H35N3O and a molecular weight of 633.80 g/mol. Its IUPAC name is 2-[(2Z,4Z)-hepta-2,4,6-trienyl]-4-[6-(6-methylcyclohexa-1,3-dien-1-yl)naphthalen-2-yl]-6-(4-phenyldibenzofuran-1-yl)-1,3,5-triazine.
| Compound Name | 2-[(2Z,4Z)-hepta-2,4,6-trienyl]-4-[6-(6-methylcyclohexa-1,3-dien-1-yl)naphthalen-2-yl]-6-(4-phenyldibenzofuran-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 170133792 |
| Molecular Formula | C45H35N3O |
| Molecular Weight | 633.80 g/mol |
| Exact Mass | 633.28 |
| IUPAC Name | 2-[(2Z,4Z)-hepta-2,4,6-trienyl]-4-[6-(6-methylcyclohexa-1,3-dien-1-yl)naphthalen-2-yl]-6-(4-phenyldibenzofuran-1-yl)-1,3,5-triazine |
| SMILES | C=C/C=C\C=C/Cc1nc(-c2ccc3cc(C4=CC=CCC4C)ccc3c2)nc(-c2ccc(-c3ccccc3)c3oc4ccccc4c23)n1 |
| InChI | InChI=1S/C45H35N3O/c1-3-4-5-6-10-21-41-46-44(35-25-23-32-28-34(24-22-33(32)29-35)36-18-12-11-15-30(36)2)48-45(47-41)39-27-26-37(31-16-8-7-9-17-31)43-42(39)38-19-13-14-20-40(38)49-43/h3-14,16-20,22-30H,1,15,21H2,2H3/b5-4-,10-6- |
| InChIKey | BJNAMJARDWNKTQ-ARSRRCBKSA-N |
| XLogP | 11.75 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.80 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|