C45H35N3O — CID 170144464
2-naphthalen-2-yl-4-(6-phenyldibenzofuran-1-yl)-6-[(2Z,4Z,6Z,8Z)-4-prop-2-enylideneundeca-2,6,8,10-tetraenyl]-1,3,5-triazine (PubChem CID 170144464) has the molecular formula C45H35N3O and a molecular weight of 633.80 g/mol. Its IUPAC name is 2-naphthalen-2-yl-4-(6-phenyldibenzofuran-1-yl)-6-[(2Z,4Z,6Z,8Z)-4-prop-2-enylideneundeca-2,6,8,10-tetraenyl]-1,3,5-triazine.
| Compound Name | 2-naphthalen-2-yl-4-(6-phenyldibenzofuran-1-yl)-6-[(2Z,4Z,6Z,8Z)-4-prop-2-enylideneundeca-2,6,8,10-tetraenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 170144464 |
| Molecular Formula | C45H35N3O |
| Molecular Weight | 633.80 g/mol |
| Exact Mass | 633.28 |
| IUPAC Name | 2-naphthalen-2-yl-4-(6-phenyldibenzofuran-1-yl)-6-[(2Z,4Z,6Z,8Z)-4-prop-2-enylideneundeca-2,6,8,10-tetraenyl]-1,3,5-triazine |
| SMILES | C=C/C=C\C=C/CC(/C=C\Cc1nc(-c2ccc3ccccc3c2)nc(-c2cccc3oc4c(-c5ccccc5)cccc4c23)n1)=C/C=C |
| InChI | InChI=1S/C45H35N3O/c1-3-5-6-7-9-18-32(17-4-2)19-14-28-41-46-44(36-30-29-33-20-12-13-23-35(33)31-36)48-45(47-41)39-26-16-27-40-42(39)38-25-15-24-37(43(38)49-40)34-21-10-8-11-22-34/h3-17,19-27,29-31H,1-2,18,28H2/b6-5-,9-7-,19-14-,32-17- |
| InChIKey | CNURRTLFRCTIEE-SIIMHVEDSA-N |
| XLogP | 11.82 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.80 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|