C17H22ClNO4S — CID 166743816
methyl 7-chloro-2,4-dimethyl-2-(1-methylsulfanylpiperidin-4-yl)-1,3-benzodioxole-5-carboxylate (PubChem CID 166743816) has the molecular formula C17H22ClNO4S and a molecular weight of 371.89 g/mol. Its IUPAC name is methyl 7-chloro-2,4-dimethyl-2-(1-methylsulfanylpiperidin-4-yl)-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl 7-chloro-2,4-dimethyl-2-(1-methylsulfanylpiperidin-4-yl)-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 166743816 |
| Molecular Formula | C17H22ClNO4S |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | methyl 7-chloro-2,4-dimethyl-2-(1-methylsulfanylpiperidin-4-yl)-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)c1cc(Cl)c2c(c1C)OC(C)(C1CCN(SC)CC1)O2 |
| InChI | InChI=1S/C17H22ClNO4S/c1-10-12(16(20)21-3)9-13(18)15-14(10)22-17(2,23-15)11-5-7-19(24-4)8-6-11/h9,11H,5-8H2,1-4H3 |
| InChIKey | MBGOTUOMECUVLG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|