C18H18ClF3O7S — CID 170420766
methyl 7-chloro-2,4-dimethyl-2-[4-(trifluoromethylsulfonyloxy)cyclohex-3-en-1-yl]-1,3-benzodioxole-5-carboxylate (PubChem CID 170420766) has the molecular formula C18H18ClF3O7S and a molecular weight of 470.85 g/mol. Its IUPAC name is methyl 7-chloro-2,4-dimethyl-2-[4-(trifluoromethylsulfonyloxy)cyclohex-3-en-1-yl]-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl 7-chloro-2,4-dimethyl-2-[4-(trifluoromethylsulfonyloxy)cyclohex-3-en-1-yl]-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 170420766 |
| Molecular Formula | C18H18ClF3O7S |
| Molecular Weight | 470.85 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | methyl 7-chloro-2,4-dimethyl-2-[4-(trifluoromethylsulfonyloxy)cyclohex-3-en-1-yl]-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)c1cc(Cl)c2c(c1C)OC(C)(C1CC=C(OS(=O)(=O)C(F)(F)F)CC1)O2 |
| InChI | InChI=1S/C18H18ClF3O7S/c1-9-12(16(23)26-3)8-13(19)15-14(9)27-17(2,28-15)10-4-6-11(7-5-10)29-30(24,25)18(20,21)22/h6,8,10H,4-5,7H2,1-3H3 |
| InChIKey | SZROLLWSMXADSA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.85 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|