C17H23ClN2O4 — CID 166745812
4-[(1S)-1-(3-chloro-5-methoxycarbonyl-2-methylanilino)ethyl]piperidine-1-carboxylic acid (PubChem CID 166745812) has the molecular formula C17H23ClN2O4 and a molecular weight of 354.83 g/mol. Its IUPAC name is 4-[(1S)-1-(3-chloro-5-methoxycarbonyl-2-methylanilino)ethyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[(1S)-1-(3-chloro-5-methoxycarbonyl-2-methylanilino)ethyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 166745812 |
| Molecular Formula | C17H23ClN2O4 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 4-[(1S)-1-(3-chloro-5-methoxycarbonyl-2-methylanilino)ethyl]piperidine-1-carboxylic acid |
| SMILES | COC(=O)c1cc(Cl)c(C)c(N[C@@H](C)C2CCN(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C17H23ClN2O4/c1-10-14(18)8-13(16(21)24-3)9-15(10)19-11(2)12-4-6-20(7-5-12)17(22)23/h8-9,11-12,19H,4-7H2,1-3H3,(H,22,23)/t11-/m0/s1 |
| InChIKey | FTIUFMHGTFXHEJ-NSHDSACASA-N |
| XLogP | 3.63 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |