C21H16ClN5O3S — CID 166748213
N-[6-[(4-chlorophenyl)sulfamoyl]-2-pyridinyl]-2-phenyl-1H-imidazole-5-carboxamide (PubChem CID 166748213) has the molecular formula C21H16ClN5O3S and a molecular weight of 453.91 g/mol. Its IUPAC name is N-[6-[(4-chlorophenyl)sulfamoyl]-2-pyridinyl]-2-phenyl-1H-imidazole-5-carboxamide.
| Compound Name | N-[6-[(4-chlorophenyl)sulfamoyl]-2-pyridinyl]-2-phenyl-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 166748213 |
| Molecular Formula | C21H16ClN5O3S |
| Molecular Weight | 453.91 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-[6-[(4-chlorophenyl)sulfamoyl]-2-pyridinyl]-2-phenyl-1H-imidazole-5-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)Nc2ccc(Cl)cc2)n1)c1cnc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C21H16ClN5O3S/c22-15-9-11-16(12-10-15)27-31(29,30)19-8-4-7-18(25-19)26-21(28)17-13-23-20(24-17)14-5-2-1-3-6-14/h1-13,27H,(H,23,24)(H,25,26,28) |
| InChIKey | AFPQMJBWQIKMIZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.91 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |