C14H20Cl2N2O3 — CID 166748763
(2S)-2-[2-(3-chlorophenyl)ethylamino]-5-(methylamino)-5-oxopentanoic acid;hydrochloride (PubChem CID 166748763) has the molecular formula C14H20Cl2N2O3 and a molecular weight of 335.23 g/mol. Its IUPAC name is (2S)-2-[2-(3-chlorophenyl)ethylamino]-5-(methylamino)-5-oxopentanoic acid;hydrochloride.
| Compound Name | (2S)-2-[2-(3-chlorophenyl)ethylamino]-5-(methylamino)-5-oxopentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 166748763 |
| Molecular Formula | C14H20Cl2N2O3 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | (2S)-2-[2-(3-chlorophenyl)ethylamino]-5-(methylamino)-5-oxopentanoic acid;hydrochloride |
| SMILES | CNC(=O)CC[C@H](NCCc1cccc(Cl)c1)C(=O)O.Cl |
| InChI | InChI=1S/C14H19ClN2O3.ClH/c1-16-13(18)6-5-12(14(19)20)17-8-7-10-3-2-4-11(15)9-10;/h2-4,9,12,17H,5-8H2,1H3,(H,16,18)(H,19,20);1H/t12-;/m0./s1 |
| InChIKey | VBORMJHHKSYSSA-YDALLXLXSA-N |
| XLogP | 1.87 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |