C23H20ClN5O4S — CID 166752119
1-benzyl-N-[5-[(4-chlorophenyl)sulfamoyl]-6-methoxy-3-pyridinyl]pyrazole-4-carboxamide (PubChem CID 166752119) has the molecular formula C23H20ClN5O4S and a molecular weight of 497.96 g/mol. Its IUPAC name is 1-benzyl-N-[5-[(4-chlorophenyl)sulfamoyl]-6-methoxy-3-pyridinyl]pyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[5-[(4-chlorophenyl)sulfamoyl]-6-methoxy-3-pyridinyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166752119 |
| Molecular Formula | C23H20ClN5O4S |
| Molecular Weight | 497.96 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | 1-benzyl-N-[5-[(4-chlorophenyl)sulfamoyl]-6-methoxy-3-pyridinyl]pyrazole-4-carboxamide |
| SMILES | COc1ncc(NC(=O)c2cnn(Cc3ccccc3)c2)cc1S(=O)(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20ClN5O4S/c1-33-23-21(34(31,32)28-19-9-7-18(24)8-10-19)11-20(13-25-23)27-22(30)17-12-26-29(15-17)14-16-5-3-2-4-6-16/h2-13,15,28H,14H2,1H3,(H,27,30) |
| InChIKey | BOHKMJKMALQVFV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.96 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |