C6H12F2N2S2 — CID 166752899
2-(3,3-difluoropyrrolidin-1-yl)-N-(disulfanyl)ethanamine (PubChem CID 166752899) has the molecular formula C6H12F2N2S2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-(3,3-difluoropyrrolidin-1-yl)-N-(disulfanyl)ethanamine.
| Compound Name | 2-(3,3-difluoropyrrolidin-1-yl)-N-(disulfanyl)ethanamine |
|---|---|
| PubChem CID | 166752899 |
| Molecular Formula | C6H12F2N2S2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 2-(3,3-difluoropyrrolidin-1-yl)-N-(disulfanyl)ethanamine |
| SMILES | FC1(F)CCN(CCNSS)C1 |
| InChI | InChI=1S/C6H12F2N2S2/c7-6(8)1-3-10(5-6)4-2-9-12-11/h9,11H,1-5H2 |
| InChIKey | QORNBVLDDGAMRD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|