C46H48Cl2FN5O6 — CID 166753197
CID 166753197 (PubChem CID 166753197) has the molecular formula C46H48Cl2FN5O6 and a molecular weight of 856.82 g/mol.
| Compound Name | CID 166753197 |
|---|---|
| PubChem CID | 166753197 |
| Molecular Formula | C46H48Cl2FN5O6 |
| Molecular Weight | 856.82 g/mol |
| Exact Mass | 855.30 |
| IUPAC Name | — |
| SMILES | CN1C(C(=O)O)[C@H](c2cccc(Cl)c2F)C2(C(=O)N(CCCCCCCC#Cc3ccc4c(c3)n(C)c(=O)n4C3CCC(=O)NC3=O)c3cc(Cl)ccc32)C12CCCCC2 |
| InChI | InChI=1S/C46H48Cl2FN5O6/c1-51-36-26-28(17-20-33(36)54(44(51)60)34-21-22-37(55)50-41(34)56)14-9-6-4-3-5-7-12-25-53-35-27-29(47)18-19-31(35)46(43(53)59)38(30-15-13-16-32(48)39(30)49)40(42(57)58)52(2)45(46)23-10-8-11-24-45/h13,15-20,26-27,34,38,40H,3-8,10-12,21-25H2,1-2H3,(H,57,58)(H,50,55,56)/t34?,38-,40?,46?/m0/s1 |
| InChIKey | QCSMCCFOTLFGOM-PRJDLMMESA-N |
| XLogP | 7.63 |
| TPSA | 133.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.82 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|