C22H28N4O2 — CID 166754116
(E)-3-[4-[6-[cyclohexyl(methyl)amino]pyridazin-3-yl]-3-hydroxyphenyl]-N-methylbut-2-enamide (PubChem CID 166754116) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is (E)-3-[4-[6-[cyclohexyl(methyl)amino]pyridazin-3-yl]-3-hydroxyphenyl]-N-methylbut-2-enamide.
| Compound Name | (E)-3-[4-[6-[cyclohexyl(methyl)amino]pyridazin-3-yl]-3-hydroxyphenyl]-N-methylbut-2-enamide |
|---|---|
| PubChem CID | 166754116 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (E)-3-[4-[6-[cyclohexyl(methyl)amino]pyridazin-3-yl]-3-hydroxyphenyl]-N-methylbut-2-enamide |
| SMILES | CNC(=O)/C=C(\C)c1ccc(-c2ccc(N(C)C3CCCCC3)nn2)c(O)c1 |
| InChI | InChI=1S/C22H28N4O2/c1-15(13-22(28)23-2)16-9-10-18(20(27)14-16)19-11-12-21(25-24-19)26(3)17-7-5-4-6-8-17/h9-14,17,27H,4-8H2,1-3H3,(H,23,28)/b15-13+ |
| InChIKey | XCBSOOMNKBCPBH-FYWRMAATSA-N |
| XLogP | 3.77 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|