C21H17N7O3 — CID 166754759
5-benzyl-N-[(3S)-2-oxo-3,4-dihydro-1H-pyridazino[4,5-g][1,5]benzoxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 166754759) has the molecular formula C21H17N7O3 and a molecular weight of 415.41 g/mol. Its IUPAC name is 5-benzyl-N-[(3S)-2-oxo-3,4-dihydro-1H-pyridazino[4,5-g][1,5]benzoxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-N-[(3S)-2-oxo-3,4-dihydro-1H-pyridazino[4,5-g][1,5]benzoxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 166754759 |
| Molecular Formula | C21H17N7O3 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 5-benzyl-N-[(3S)-2-oxo-3,4-dihydro-1H-pyridazino[4,5-g][1,5]benzoxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(N[C@H]1COc2ccc3cnncc3c2NC1=O)c1n[nH]c(Cc2ccccc2)n1 |
| InChI | InChI=1S/C21H17N7O3/c29-20-15(11-31-16-7-6-13-9-22-23-10-14(13)18(16)26-20)24-21(30)19-25-17(27-28-19)8-12-4-2-1-3-5-12/h1-7,9-10,15H,8,11H2,(H,24,30)(H,26,29)(H,25,27,28)/t15-/m0/s1 |
| InChIKey | ZSQYWPOSTOCXTD-HNNXBMFYSA-N |
| XLogP | 1.47 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |