C20H21N5O2S — CID 129290419
5-benzyl-N-(6,8-dimethyl-2-oxo-1,3,4,5-tetrahydrothieno[3,4-b]azepin-3-yl)-1H-1,2,4-triazole-3-carboxamide (PubChem CID 129290419) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is 5-benzyl-N-(6,8-dimethyl-2-oxo-1,3,4,5-tetrahydrothieno[3,4-b]azepin-3-yl)-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-N-(6,8-dimethyl-2-oxo-1,3,4,5-tetrahydrothieno[3,4-b]azepin-3-yl)-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 129290419 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 5-benzyl-N-(6,8-dimethyl-2-oxo-1,3,4,5-tetrahydrothieno[3,4-b]azepin-3-yl)-1H-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1sc(C)c2c1CCC(NC(=O)c1n[nH]c(Cc3ccccc3)n1)C(=O)N2 |
| InChI | InChI=1S/C20H21N5O2S/c1-11-14-8-9-15(19(26)23-17(14)12(2)28-11)21-20(27)18-22-16(24-25-18)10-13-6-4-3-5-7-13/h3-7,15H,8-10H2,1-2H3,(H,21,27)(H,23,26)(H,22,24,25) |
| InChIKey | LVSLUSALWIPEKH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |