C23H21N5O2 — CID 159590976
5-benzyl-N-(2-oxo-3,4,5,6-tetrahydro-1H-indeno[1,2-b]azepin-3-yl)-1H-1,2,4-triazole-3-carboxamide (PubChem CID 159590976) has the molecular formula C23H21N5O2 and a molecular weight of 399.45 g/mol. Its IUPAC name is 5-benzyl-N-(2-oxo-3,4,5,6-tetrahydro-1H-indeno[1,2-b]azepin-3-yl)-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-N-(2-oxo-3,4,5,6-tetrahydro-1H-indeno[1,2-b]azepin-3-yl)-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 159590976 |
| Molecular Formula | C23H21N5O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 5-benzyl-N-(2-oxo-3,4,5,6-tetrahydro-1H-indeno[1,2-b]azepin-3-yl)-1H-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(NC1CCC2=C(NC1=O)c1ccccc1C2)c1n[nH]c(Cc2ccccc2)n1 |
| InChI | InChI=1S/C23H21N5O2/c29-22-18(11-10-16-13-15-8-4-5-9-17(15)20(16)26-22)24-23(30)21-25-19(27-28-21)12-14-6-2-1-3-7-14/h1-9,18H,10-13H2,(H,24,30)(H,26,29)(H,25,27,28) |
| InChIKey | YTUYGCSUWWYKJX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |