C24H23N7O2 — CID 118557055
5-benzyl-N-[7-(1-methylpyrazol-3-yl)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 118557055) has the molecular formula C24H23N7O2 and a molecular weight of 441.50 g/mol. Its IUPAC name is 5-benzyl-N-[7-(1-methylpyrazol-3-yl)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-N-[7-(1-methylpyrazol-3-yl)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 118557055 |
| Molecular Formula | C24H23N7O2 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 5-benzyl-N-[7-(1-methylpyrazol-3-yl)-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | Cn1ccc(-c2ccc3c(c2)CCC(NC(=O)c2n[nH]c(Cc4ccccc4)n2)C(=O)N3)n1 |
| InChI | InChI=1S/C24H23N7O2/c1-31-12-11-19(30-31)17-7-9-18-16(14-17)8-10-20(23(32)25-18)26-24(33)22-27-21(28-29-22)13-15-5-3-2-4-6-15/h2-7,9,11-12,14,20H,8,10,13H2,1H3,(H,25,32)(H,26,33)(H,27,28,29) |
| InChIKey | YXIARUKINYPXKU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |