C17H16N6O2S — CID 129290426
5-benzyl-N-[(3R)-4-oxo-3,5-dihydro-2H-pyrrolo[2,1-b][1,3,4]thiadiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 129290426) has the molecular formula C17H16N6O2S and a molecular weight of 368.42 g/mol. Its IUPAC name is 5-benzyl-N-[(3R)-4-oxo-3,5-dihydro-2H-pyrrolo[2,1-b][1,3,4]thiadiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-N-[(3R)-4-oxo-3,5-dihydro-2H-pyrrolo[2,1-b][1,3,4]thiadiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 129290426 |
| Molecular Formula | C17H16N6O2S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 5-benzyl-N-[(3R)-4-oxo-3,5-dihydro-2H-pyrrolo[2,1-b][1,3,4]thiadiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(N[C@H]1CSc2cccn2NC1=O)c1n[nH]c(Cc2ccccc2)n1 |
| InChI | InChI=1S/C17H16N6O2S/c24-16-12(10-26-14-7-4-8-23(14)22-16)18-17(25)15-19-13(20-21-15)9-11-5-2-1-3-6-11/h1-8,12H,9-10H2,(H,18,25)(H,22,24)(H,19,20,21)/t12-/m0/s1 |
| InChIKey | GKXLEPFFFFZASE-LBPRGKRZSA-N |
| XLogP | 1.17 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |