C24H24N6O2S — CID 158241509
5-benzyl-N-[(3R)-1-methyl-2-oxo-3,4-dihydropyrido[3,2-g][1,5]benzothiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide;methane (PubChem CID 158241509) has the molecular formula C24H24N6O2S and a molecular weight of 460.56 g/mol. Its IUPAC name is 5-benzyl-N-[(3R)-1-methyl-2-oxo-3,4-dihydropyrido[3,2-g][1,5]benzothiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide;methane.
| Compound Name | 5-benzyl-N-[(3R)-1-methyl-2-oxo-3,4-dihydropyrido[3,2-g][1,5]benzothiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide;methane |
|---|---|
| PubChem CID | 158241509 |
| Molecular Formula | C24H24N6O2S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 5-benzyl-N-[(3R)-1-methyl-2-oxo-3,4-dihydropyrido[3,2-g][1,5]benzothiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide;methane |
| SMILES | C.CN1C(=O)[C@@H](NC(=O)c2n[nH]c(Cc3ccccc3)n2)CSc2ccc3ncccc3c21 |
| InChI | InChI=1S/C23H20N6O2S.CH4/c1-29-20-15-8-5-11-24-16(15)9-10-18(20)32-13-17(23(29)31)25-22(30)21-26-19(27-28-21)12-14-6-3-2-4-7-14;/h2-11,17H,12-13H2,1H3,(H,25,30)(H,26,27,28);1H4/t17-;/m0./s1 |
| InChIKey | GFPBZXSBRJDEJP-LMOVPXPDSA-N |
| XLogP | 3.45 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |