C24H23N7O3S — CID 168951902
5-benzyl-N-[(3R)-8-(furan-2-ylmethylamino)-5-methyl-4-oxo-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 168951902) has the molecular formula C24H23N7O3S and a molecular weight of 489.56 g/mol. Its IUPAC name is 5-benzyl-N-[(3R)-8-(furan-2-ylmethylamino)-5-methyl-4-oxo-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-N-[(3R)-8-(furan-2-ylmethylamino)-5-methyl-4-oxo-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 168951902 |
| Molecular Formula | C24H23N7O3S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 5-benzyl-N-[(3R)-8-(furan-2-ylmethylamino)-5-methyl-4-oxo-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CN1C(=O)[C@@H](NC(=O)c2n[nH]c(Cc3ccccc3)n2)CSc2cc(NCc3ccco3)ncc21 |
| InChI | InChI=1S/C24H23N7O3S/c1-31-18-13-26-20(25-12-16-8-5-9-34-16)11-19(18)35-14-17(24(31)33)27-23(32)22-28-21(29-30-22)10-15-6-3-2-4-7-15/h2-9,11,13,17H,10,12,14H2,1H3,(H,25,26)(H,27,32)(H,28,29,30)/t17-/m0/s1 |
| InChIKey | HKIISWPHCSXYRF-KRWDZBQOSA-N |
| XLogP | 2.86 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |