C21H23N7O2S — CID 168952424
5-benzyl-N-[(3R)-8-(dimethylamino)-1-methyl-2-oxo-3,4-dihydropyrido[3,4-b][1,4]thiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 168952424) has the molecular formula C21H23N7O2S and a molecular weight of 437.53 g/mol. Its IUPAC name is 5-benzyl-N-[(3R)-8-(dimethylamino)-1-methyl-2-oxo-3,4-dihydropyrido[3,4-b][1,4]thiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-N-[(3R)-8-(dimethylamino)-1-methyl-2-oxo-3,4-dihydropyrido[3,4-b][1,4]thiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 168952424 |
| Molecular Formula | C21H23N7O2S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 5-benzyl-N-[(3R)-8-(dimethylamino)-1-methyl-2-oxo-3,4-dihydropyrido[3,4-b][1,4]thiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CN(C)c1cc2c(cn1)SC[C@H](NC(=O)c1n[nH]c(Cc3ccccc3)n1)C(=O)N2C |
| InChI | InChI=1S/C21H23N7O2S/c1-27(2)18-10-15-16(11-22-18)31-12-14(21(30)28(15)3)23-20(29)19-24-17(25-26-19)9-13-7-5-4-6-8-13/h4-8,10-11,14H,9,12H2,1-3H3,(H,23,29)(H,24,25,26)/t14-/m0/s1 |
| InChIKey | ORTVLTYLERUFFB-AWEZNQCLSA-N |
| XLogP | 1.72 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |