C19H17N7OS — CID 162696685
5-benzyl-N-(9-thia-1,2,5-triazatricyclo[8.3.0.02,6]trideca-3,5,10,12-tetraen-7-yl)-1H-1,2,4-triazole-3-carboxamide (PubChem CID 162696685) has the molecular formula C19H17N7OS and a molecular weight of 391.46 g/mol. Its IUPAC name is 5-benzyl-N-(9-thia-1,2,5-triazatricyclo[8.3.0.02,6]trideca-3,5,10,12-tetraen-7-yl)-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-N-(9-thia-1,2,5-triazatricyclo[8.3.0.02,6]trideca-3,5,10,12-tetraen-7-yl)-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 162696685 |
| Molecular Formula | C19H17N7OS |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 5-benzyl-N-(9-thia-1,2,5-triazatricyclo[8.3.0.02,6]trideca-3,5,10,12-tetraen-7-yl)-1H-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(NC1CSc2cccn2-n2ccnc21)c1n[nH]c(Cc2ccccc2)n1 |
| InChI | InChI=1S/C19H17N7OS/c27-19(17-22-15(23-24-17)11-13-5-2-1-3-6-13)21-14-12-28-16-7-4-9-25(16)26-10-8-20-18(14)26/h1-10,14H,11-12H2,(H,21,27)(H,22,23,24) |
| InChIKey | SHVFJHMSTGXYBK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |