C25H26F2N2O2S — CID 166755951
3-[bis(4-fluorophenyl)methyl]-N-(4-methylphenyl)piperidine-1-sulfonamide (PubChem CID 166755951) has the molecular formula C25H26F2N2O2S and a molecular weight of 456.56 g/mol. Its IUPAC name is 3-[bis(4-fluorophenyl)methyl]-N-(4-methylphenyl)piperidine-1-sulfonamide.
| Compound Name | 3-[bis(4-fluorophenyl)methyl]-N-(4-methylphenyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 166755951 |
| Molecular Formula | C25H26F2N2O2S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 3-[bis(4-fluorophenyl)methyl]-N-(4-methylphenyl)piperidine-1-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)N2CCCC(C(c3ccc(F)cc3)c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C25H26F2N2O2S/c1-18-4-14-24(15-5-18)28-32(30,31)29-16-2-3-21(17-29)25(19-6-10-22(26)11-7-19)20-8-12-23(27)13-9-20/h4-15,21,25,28H,2-3,16-17H2,1H3 |
| InChIKey | APUDFGVUCCAGEE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |