C15H9Cl3N2O3 — CID 166756395
methyl 3,5,6-trichloro-4-(3-oxo-1H-isoindol-2-yl)pyridine-2-carboxylate (PubChem CID 166756395) has the molecular formula C15H9Cl3N2O3 and a molecular weight of 371.61 g/mol. Its IUPAC name is methyl 3,5,6-trichloro-4-(3-oxo-1H-isoindol-2-yl)pyridine-2-carboxylate.
| Compound Name | methyl 3,5,6-trichloro-4-(3-oxo-1H-isoindol-2-yl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 166756395 |
| Molecular Formula | C15H9Cl3N2O3 |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | methyl 3,5,6-trichloro-4-(3-oxo-1H-isoindol-2-yl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(Cl)c(Cl)c(N2Cc3ccccc3C2=O)c1Cl |
| InChI | InChI=1S/C15H9Cl3N2O3/c1-23-15(22)11-9(16)12(10(17)13(18)19-11)20-6-7-4-2-3-5-8(7)14(20)21/h2-5H,6H2,1H3 |
| InChIKey | YHXFJMDWONFOLQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|