C20H40O4 — CID 166757933
(Z)-1,2-dibutoxy-1-(methoxymethoxy)dec-1-ene (PubChem CID 166757933) has the molecular formula C20H40O4 and a molecular weight of 344.54 g/mol. Its IUPAC name is (Z)-1,2-dibutoxy-1-(methoxymethoxy)dec-1-ene.
| Compound Name | (Z)-1,2-dibutoxy-1-(methoxymethoxy)dec-1-ene |
|---|---|
| PubChem CID | 166757933 |
| Molecular Formula | C20H40O4 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.29 |
| IUPAC Name | (Z)-1,2-dibutoxy-1-(methoxymethoxy)dec-1-ene |
| SMILES | CCCCCCCC/C(OCCCC)=C(\OCCCC)OCOC |
| InChI | InChI=1S/C20H40O4/c1-5-8-11-12-13-14-15-19(22-16-9-6-2)20(24-18-21-4)23-17-10-7-3/h5-18H2,1-4H3/b20-19- |
| InChIKey | UVSKDGBMPYTSNH-VXPUYCOJSA-N |
| XLogP | 6.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|