C17H34O4 — CID 166757454
1-(methoxymethoxy)-1,2-dipentoxypent-1-ene (PubChem CID 166757454) has the molecular formula C17H34O4 and a molecular weight of 302.45 g/mol. Its IUPAC name is 1-(methoxymethoxy)-1,2-dipentoxypent-1-ene.
| Compound Name | 1-(methoxymethoxy)-1,2-dipentoxypent-1-ene |
|---|---|
| PubChem CID | 166757454 |
| Molecular Formula | C17H34O4 |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | 1-(methoxymethoxy)-1,2-dipentoxypent-1-ene |
| SMILES | CCCCCOC(CCC)=C(OCCCCC)OCOC |
| InChI | InChI=1S/C17H34O4/c1-5-8-10-13-19-16(12-7-3)17(21-15-18-4)20-14-11-9-6-2/h5-15H2,1-4H3 |
| InChIKey | VBIVGRDBUDHPNH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|