C22H44O4 — CID 166758903
1-[[(Z)-1,2-dibutoxypent-1-enoxy]methoxy]octane (PubChem CID 166758903) has the molecular formula C22H44O4 and a molecular weight of 372.59 g/mol. Its IUPAC name is 1-[[(Z)-1,2-dibutoxypent-1-enoxy]methoxy]octane.
| Compound Name | 1-[[(Z)-1,2-dibutoxypent-1-enoxy]methoxy]octane |
|---|---|
| PubChem CID | 166758903 |
| Molecular Formula | C22H44O4 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.32 |
| IUPAC Name | 1-[[(Z)-1,2-dibutoxypent-1-enoxy]methoxy]octane |
| SMILES | CCCCCCCCOCO/C(OCCCC)=C(/CCC)OCCCC |
| InChI | InChI=1S/C22H44O4/c1-5-9-12-13-14-15-17-23-20-26-22(25-19-11-7-3)21(16-8-4)24-18-10-6-2/h5-20H2,1-4H3/b22-21- |
| InChIKey | KGEFEXGTRICXJK-DQRAZIAOSA-N |
| XLogP | 6.94 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|