C14H16FNO4 — CID 166759574
1-[(7-fluoro-2-formyl-2,3-dihydro-1H-inden-5-yl)oxy]propan-2-ylcarbamic acid (PubChem CID 166759574) has the molecular formula C14H16FNO4 and a molecular weight of 281.28 g/mol. Its IUPAC name is 1-[(7-fluoro-2-formyl-2,3-dihydro-1H-inden-5-yl)oxy]propan-2-ylcarbamic acid.
| Compound Name | 1-[(7-fluoro-2-formyl-2,3-dihydro-1H-inden-5-yl)oxy]propan-2-ylcarbamic acid |
|---|---|
| PubChem CID | 166759574 |
| Molecular Formula | C14H16FNO4 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 1-[(7-fluoro-2-formyl-2,3-dihydro-1H-inden-5-yl)oxy]propan-2-ylcarbamic acid |
| SMILES | CC(COc1cc(F)c2c(c1)CC(C=O)C2)NC(=O)O |
| InChI | InChI=1S/C14H16FNO4/c1-8(16-14(18)19)7-20-11-4-10-2-9(6-17)3-12(10)13(15)5-11/h4-6,8-9,16H,2-3,7H2,1H3,(H,18,19) |
| InChIKey | JDPCZGMKFPFNEK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|