C11H12ClF2NO3 — CID 146662746
[(2R)-1-[2-(chloromethyl)-4,6-difluorophenoxy]propan-2-yl]carbamic acid (PubChem CID 146662746) has the molecular formula C11H12ClF2NO3 and a molecular weight of 279.67 g/mol. Its IUPAC name is [(2R)-1-[2-(chloromethyl)-4,6-difluorophenoxy]propan-2-yl]carbamic acid.
| Compound Name | [(2R)-1-[2-(chloromethyl)-4,6-difluorophenoxy]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 146662746 |
| Molecular Formula | C11H12ClF2NO3 |
| Molecular Weight | 279.67 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | [(2R)-1-[2-(chloromethyl)-4,6-difluorophenoxy]propan-2-yl]carbamic acid |
| SMILES | C[C@H](COc1c(F)cc(F)cc1CCl)NC(=O)O |
| InChI | InChI=1S/C11H12ClF2NO3/c1-6(15-11(16)17)5-18-10-7(4-12)2-8(13)3-9(10)14/h2-3,6,15H,4-5H2,1H3,(H,16,17)/t6-/m1/s1 |
| InChIKey | FZXLQGHQBYOWBM-ZCFIWIBFSA-N |
| XLogP | 2.74 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.67 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|