C23H24N6O7 — CID 166759653
formic acid;2-[[2-hydroxy-3-[2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]propyl]amino]-2,3-dihydro-1H-indene-4-carbonitrile (PubChem CID 166759653) has the molecular formula C23H24N6O7 and a molecular weight of 496.48 g/mol. Its IUPAC name is formic acid;2-[[2-hydroxy-3-[2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]propyl]amino]-2,3-dihydro-1H-indene-4-carbonitrile.
| Compound Name | formic acid;2-[[2-hydroxy-3-[2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]propyl]amino]-2,3-dihydro-1H-indene-4-carbonitrile |
|---|---|
| PubChem CID | 166759653 |
| Molecular Formula | C23H24N6O7 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | formic acid;2-[[2-hydroxy-3-[2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]propyl]amino]-2,3-dihydro-1H-indene-4-carbonitrile |
| SMILES | N#Cc1cccc2c1CC(NCC(O)CC1CN(c3cnc4c(n3)NC(=O)CO4)C(=O)O1)C2.O=CO |
| InChI | InChI=1S/C22H22N6O5.CH2O2/c23-7-13-3-1-2-12-4-14(5-17(12)13)24-8-15(29)6-16-10-28(22(31)33-16)18-9-25-21-20(26-18)27-19(30)11-32-21;2-1-3/h1-3,9,14-16,24,29H,4-6,8,10-11H2,(H,26,27,30);1H,(H,2,3) |
| InChIKey | KTRINKDGIGORQR-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 187.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|