C28H31FN6O9 — CID 166759351
1-[2-[[7-fluoro-2-[[2-[2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethylamino]methyl]-2,3-dihydro-1H-inden-5-yl]oxy]ethyl]pyrrolidine-2,5-dione;formic acid (PubChem CID 166759351) has the molecular formula C28H31FN6O9 and a molecular weight of 614.59 g/mol. Its IUPAC name is 1-[2-[[7-fluoro-2-[[2-[2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethylamino]methyl]-2,3-dihydro-1H-inden-5-yl]oxy]ethyl]pyrrolidine-2,5-dione;formic acid.
| Compound Name | 1-[2-[[7-fluoro-2-[[2-[2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethylamino]methyl]-2,3-dihydro-1H-inden-5-yl]oxy]ethyl]pyrrolidine-2,5-dione;formic acid |
|---|---|
| PubChem CID | 166759351 |
| Molecular Formula | C28H31FN6O9 |
| Molecular Weight | 614.59 g/mol |
| Exact Mass | 614.21 |
| IUPAC Name | 1-[2-[[7-fluoro-2-[[2-[2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethylamino]methyl]-2,3-dihydro-1H-inden-5-yl]oxy]ethyl]pyrrolidine-2,5-dione;formic acid |
| SMILES | O=C1COc2ncc(N3CC(CCNCC4Cc5cc(OCCN6C(=O)CCC6=O)cc(F)c5C4)OC3=O)nc2N1.O=CO |
| InChI | InChI=1S/C27H29FN6O7.CH2O2/c28-20-10-18(39-6-5-33-23(36)1-2-24(33)37)9-16-7-15(8-19(16)20)11-29-4-3-17-13-34(27(38)41-17)21-12-30-26-25(31-21)32-22(35)14-40-26;2-1-3/h9-10,12,15,17,29H,1-8,11,13-14H2,(H,31,32,35);1H,(H,2,3) |
| InChIKey | DHAYGEALKVEOIU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 189.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.59 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|