C25H28FN7O7 — CID 167514454
3-amino-4-[[7-fluoro-2-[[2-[2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethylamino]methyl]-2,3-dihydro-1H-inden-5-yl]amino]-4-oxobutanoic acid (PubChem CID 167514454) has the molecular formula C25H28FN7O7 and a molecular weight of 557.54 g/mol. Its IUPAC name is 3-amino-4-[[7-fluoro-2-[[2-[2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethylamino]methyl]-2,3-dihydro-1H-inden-5-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[7-fluoro-2-[[2-[2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethylamino]methyl]-2,3-dihydro-1H-inden-5-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 167514454 |
| Molecular Formula | C25H28FN7O7 |
| Molecular Weight | 557.54 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | 3-amino-4-[[7-fluoro-2-[[2-[2-oxo-3-(3-oxo-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)-1,3-oxazolidin-5-yl]ethylamino]methyl]-2,3-dihydro-1H-inden-5-yl]amino]-4-oxobutanoic acid |
| SMILES | NC(CC(=O)O)C(=O)Nc1cc(F)c2c(c1)CC(CNCCC1CN(c3cnc4c(n3)NC(=O)CO4)C(=O)O1)C2 |
| InChI | InChI=1S/C25H28FN7O7/c26-17-6-14(30-23(37)18(27)7-21(35)36)5-13-3-12(4-16(13)17)8-28-2-1-15-10-33(25(38)40-15)19-9-29-24-22(31-19)32-20(34)11-39-24/h5-6,9,12,15,18,28H,1-4,7-8,10-11,27H2,(H,30,37)(H,35,36)(H,31,32,34) |
| InChIKey | ASJCUBWUCANWSC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 198.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.54 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|