C25H27FN8O5 — CID 156861981
6-[5-[2-[[4-fluoro-6-[2-(1,2,4-triazol-1-yl)ethoxy]-2,3-dihydro-1H-inden-2-yl]methylamino]ethyl]-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one (PubChem CID 156861981) has the molecular formula C25H27FN8O5 and a molecular weight of 538.54 g/mol. Its IUPAC name is 6-[5-[2-[[4-fluoro-6-[2-(1,2,4-triazol-1-yl)ethoxy]-2,3-dihydro-1H-inden-2-yl]methylamino]ethyl]-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one.
| Compound Name | 6-[5-[2-[[4-fluoro-6-[2-(1,2,4-triazol-1-yl)ethoxy]-2,3-dihydro-1H-inden-2-yl]methylamino]ethyl]-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 156861981 |
| Molecular Formula | C25H27FN8O5 |
| Molecular Weight | 538.54 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 6-[5-[2-[[4-fluoro-6-[2-(1,2,4-triazol-1-yl)ethoxy]-2,3-dihydro-1H-inden-2-yl]methylamino]ethyl]-2-oxo-1,3-oxazolidin-3-yl]-4H-pyrazino[2,3-b][1,4]oxazin-3-one |
| SMILES | O=C1COc2ncc(N3CC(CCNCC4Cc5cc(OCCn6cncn6)cc(F)c5C4)OC3=O)nc2N1 |
| InChI | InChI=1S/C25H27FN8O5/c26-20-8-18(37-4-3-33-14-28-13-30-33)7-16-5-15(6-19(16)20)9-27-2-1-17-11-34(25(36)39-17)21-10-29-24-23(31-21)32-22(35)12-38-24/h7-8,10,13-15,17,27H,1-6,9,11-12H2,(H,31,32,35) |
| InChIKey | BQFIUJATJKVPKB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 145.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.54 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|