C20H24N4O2S — CID 16676164
N-[3-[cyclohexyl(methyl)carbamoyl]phenyl]-2-methylsulfanylpyrimidine-5-carboxamide (PubChem CID 16676164) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is N-[3-[cyclohexyl(methyl)carbamoyl]phenyl]-2-methylsulfanylpyrimidine-5-carboxamide.
| Compound Name | N-[3-[cyclohexyl(methyl)carbamoyl]phenyl]-2-methylsulfanylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 16676164 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[3-[cyclohexyl(methyl)carbamoyl]phenyl]-2-methylsulfanylpyrimidine-5-carboxamide |
| SMILES | CSc1ncc(C(=O)Nc2cccc(C(=O)N(C)C3CCCCC3)c2)cn1 |
| InChI | InChI=1S/C20H24N4O2S/c1-24(17-9-4-3-5-10-17)19(26)14-7-6-8-16(11-14)23-18(25)15-12-21-20(27-2)22-13-15/h6-8,11-13,17H,3-5,9-10H2,1-2H3,(H,23,25) |
| InChIKey | IBLAOWBCUZIWFY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |